C12H14ClF3N4 — CID 114562342
2-chloro-4-(4-cyclopropylpiperazin-1-yl)-6-(trifluoromethyl)pyrimidine (PubChem CID 114562342) has the molecular formula C12H14ClF3N4 and a molecular weight of 306.72 g/mol. Its IUPAC name is 2-chloro-4-(4-cyclopropylpiperazin-1-yl)-6-(trifluoromethyl)pyrimidine.
| Compound Name | 2-chloro-4-(4-cyclopropylpiperazin-1-yl)-6-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 114562342 |
| Molecular Formula | C12H14ClF3N4 |
| Molecular Weight | 306.72 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 2-chloro-4-(4-cyclopropylpiperazin-1-yl)-6-(trifluoromethyl)pyrimidine |
| SMILES | FC(F)(F)c1cc(N2CCN(C3CC3)CC2)nc(Cl)n1 |
| InChI | InChI=1S/C12H14ClF3N4/c13-11-17-9(12(14,15)16)7-10(18-11)20-5-3-19(4-6-20)8-1-2-8/h7-8H,1-6H2 |
| InChIKey | HRWFZWNKFTXFDW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.72 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |