C19H22F3N5 — CID 133318191
2-pyridin-4-yl-4-(4-pyrrolidin-1-ylpiperidin-1-yl)-6-(trifluoromethyl)pyrimidine (PubChem CID 133318191) has the molecular formula C19H22F3N5 and a molecular weight of 377.41 g/mol. Its IUPAC name is 2-pyridin-4-yl-4-(4-pyrrolidin-1-ylpiperidin-1-yl)-6-(trifluoromethyl)pyrimidine.
| Compound Name | 2-pyridin-4-yl-4-(4-pyrrolidin-1-ylpiperidin-1-yl)-6-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 133318191 |
| Molecular Formula | C19H22F3N5 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 2-pyridin-4-yl-4-(4-pyrrolidin-1-ylpiperidin-1-yl)-6-(trifluoromethyl)pyrimidine |
| SMILES | FC(F)(F)c1cc(N2CCC(N3CCCC3)CC2)nc(-c2ccncc2)n1 |
| InChI | InChI=1S/C19H22F3N5/c20-19(21,22)16-13-17(25-18(24-16)14-3-7-23-8-4-14)27-11-5-15(6-12-27)26-9-1-2-10-26/h3-4,7-8,13,15H,1-2,5-6,9-12H2 |
| InChIKey | GPLHXHCFNGLAGG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |