C22H20F3N5O2 — CID 133329180
N-(2-hydroxyphenyl)-1-[2-pyridin-4-yl-6-(trifluoromethyl)pyrimidin-4-yl]piperidine-4-carboxamide (PubChem CID 133329180) has the molecular formula C22H20F3N5O2 and a molecular weight of 443.43 g/mol. Its IUPAC name is N-(2-hydroxyphenyl)-1-[2-pyridin-4-yl-6-(trifluoromethyl)pyrimidin-4-yl]piperidine-4-carboxamide.
| Compound Name | N-(2-hydroxyphenyl)-1-[2-pyridin-4-yl-6-(trifluoromethyl)pyrimidin-4-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 133329180 |
| Molecular Formula | C22H20F3N5O2 |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | N-(2-hydroxyphenyl)-1-[2-pyridin-4-yl-6-(trifluoromethyl)pyrimidin-4-yl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1O)C1CCN(c2cc(C(F)(F)F)nc(-c3ccncc3)n2)CC1 |
| InChI | InChI=1S/C22H20F3N5O2/c23-22(24,25)18-13-19(29-20(28-18)14-5-9-26-10-6-14)30-11-7-15(8-12-30)21(32)27-16-3-1-2-4-17(16)31/h1-6,9-10,13,15,31H,7-8,11-12H2,(H,27,32) |
| InChIKey | BJHZPMPXAJIFKC-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|