C21H19F3N4 — CID 133329913
4-(4-phenylpiperidin-1-yl)-2-pyridin-4-yl-6-(trifluoromethyl)pyrimidine (PubChem CID 133329913) has the molecular formula C21H19F3N4 and a molecular weight of 384.41 g/mol. Its IUPAC name is 4-(4-phenylpiperidin-1-yl)-2-pyridin-4-yl-6-(trifluoromethyl)pyrimidine.
| Compound Name | 4-(4-phenylpiperidin-1-yl)-2-pyridin-4-yl-6-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 133329913 |
| Molecular Formula | C21H19F3N4 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | 4-(4-phenylpiperidin-1-yl)-2-pyridin-4-yl-6-(trifluoromethyl)pyrimidine |
| SMILES | FC(F)(F)c1cc(N2CCC(c3ccccc3)CC2)nc(-c2ccncc2)n1 |
| InChI | InChI=1S/C21H19F3N4/c22-21(23,24)18-14-19(27-20(26-18)17-6-10-25-11-7-17)28-12-8-16(9-13-28)15-4-2-1-3-5-15/h1-7,10-11,14,16H,8-9,12-13H2 |
| InChIKey | QUZCYJOPWRSXIQ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |