C11H10ClF6N3 — CID 114562711
2-chloro-4-(trifluoromethyl)-6-[4-(trifluoromethyl)piperidin-1-yl]pyrimidine (PubChem CID 114562711) has the molecular formula C11H10ClF6N3 and a molecular weight of 333.66 g/mol. Its IUPAC name is 2-chloro-4-(trifluoromethyl)-6-[4-(trifluoromethyl)piperidin-1-yl]pyrimidine.
| Compound Name | 2-chloro-4-(trifluoromethyl)-6-[4-(trifluoromethyl)piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 114562711 |
| Molecular Formula | C11H10ClF6N3 |
| Molecular Weight | 333.66 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 2-chloro-4-(trifluoromethyl)-6-[4-(trifluoromethyl)piperidin-1-yl]pyrimidine |
| SMILES | FC(F)(F)c1cc(N2CCC(C(F)(F)F)CC2)nc(Cl)n1 |
| InChI | InChI=1S/C11H10ClF6N3/c12-9-19-7(11(16,17)18)5-8(20-9)21-3-1-6(2-4-21)10(13,14)15/h5-6H,1-4H2 |
| InChIKey | GCXQINYLCFUEPR-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.66 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |