C13H22N6O — CID 80964808
1-(6-hydrazinyl-2-propan-2-ylpyrimidin-4-yl)piperidine-2-carboxamide (PubChem CID 80964808) has the molecular formula C13H22N6O and a molecular weight of 278.36 g/mol. Its IUPAC name is 1-(6-hydrazinyl-2-propan-2-ylpyrimidin-4-yl)piperidine-2-carboxamide.
| Compound Name | 1-(6-hydrazinyl-2-propan-2-ylpyrimidin-4-yl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 80964808 |
| Molecular Formula | C13H22N6O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 1-(6-hydrazinyl-2-propan-2-ylpyrimidin-4-yl)piperidine-2-carboxamide |
| SMILES | CC(C)c1nc(NN)cc(N2CCCCC2C(N)=O)n1 |
| InChI | InChI=1S/C13H22N6O/c1-8(2)13-16-10(18-15)7-11(17-13)19-6-4-3-5-9(19)12(14)20/h7-9H,3-6,15H2,1-2H3,(H2,14,20)(H,16,17,18) |
| InChIKey | WQKXZUUUAUTDHI-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|