C9H14N6O — CID 80932532
1-(6-hydrazinylpyrimidin-4-yl)pyrrolidine-2-carboxamide (PubChem CID 80932532) has the molecular formula C9H14N6O and a molecular weight of 222.25 g/mol. Its IUPAC name is 1-(6-hydrazinylpyrimidin-4-yl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(6-hydrazinylpyrimidin-4-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 80932532 |
| Molecular Formula | C9H14N6O |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 1-(6-hydrazinylpyrimidin-4-yl)pyrrolidine-2-carboxamide |
| SMILES | NNc1cc(N2CCCC2C(N)=O)ncn1 |
| InChI | InChI=1S/C9H14N6O/c10-9(16)6-2-1-3-15(6)8-4-7(14-11)12-5-13-8/h4-6H,1-3,11H2,(H2,10,16)(H,12,13,14) |
| InChIKey | UNBJKHRFJVEXNW-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|