C12H17F3N4S — CID 80847744
N-methyl-2-methylsulfanyl-6-[3-(trifluoromethyl)piperidin-1-yl]pyrimidin-4-amine (PubChem CID 80847744) has the molecular formula C12H17F3N4S and a molecular weight of 306.36 g/mol. Its IUPAC name is N-methyl-2-methylsulfanyl-6-[3-(trifluoromethyl)piperidin-1-yl]pyrimidin-4-amine.
| Compound Name | N-methyl-2-methylsulfanyl-6-[3-(trifluoromethyl)piperidin-1-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 80847744 |
| Molecular Formula | C12H17F3N4S |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | N-methyl-2-methylsulfanyl-6-[3-(trifluoromethyl)piperidin-1-yl]pyrimidin-4-amine |
| SMILES | CNc1cc(N2CCCC(C(F)(F)F)C2)nc(SC)n1 |
| InChI | InChI=1S/C12H17F3N4S/c1-16-9-6-10(18-11(17-9)20-2)19-5-3-4-8(7-19)12(13,14)15/h6,8H,3-5,7H2,1-2H3,(H,16,17,18) |
| InChIKey | SPVRWLZIZAYYSY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |