C19H29FN6O — CID 23653033
N-[6-(4-cyclopentylpiperazin-1-yl)pyrimidin-4-yl]-4-fluoropiperidine-1-carboxamide (PubChem CID 23653033) has the molecular formula C19H29FN6O and a molecular weight of 376.48 g/mol. Its IUPAC name is N-[6-(4-cyclopentylpiperazin-1-yl)pyrimidin-4-yl]-4-fluoropiperidine-1-carboxamide.
| Compound Name | N-[6-(4-cyclopentylpiperazin-1-yl)pyrimidin-4-yl]-4-fluoropiperidine-1-carboxamide |
|---|---|
| PubChem CID | 23653033 |
| Molecular Formula | C19H29FN6O |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | N-[6-(4-cyclopentylpiperazin-1-yl)pyrimidin-4-yl]-4-fluoropiperidine-1-carboxamide |
| SMILES | O=C(Nc1cc(N2CCN(C3CCCC3)CC2)ncn1)N1CCC(F)CC1 |
| InChI | InChI=1S/C19H29FN6O/c20-15-5-7-26(8-6-15)19(27)23-17-13-18(22-14-21-17)25-11-9-24(10-12-25)16-3-1-2-4-16/h13-16H,1-12H2,(H,21,22,23,27) |
| InChIKey | OYIFIGNOGFWSKP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |