C20H32N6O — CID 133492339
4-[6-[(1-cyclohexylpiperidin-4-yl)amino]pyrimidin-4-yl]-1-methylpiperazin-2-one (PubChem CID 133492339) has the molecular formula C20H32N6O and a molecular weight of 372.52 g/mol. Its IUPAC name is 4-[6-[(1-cyclohexylpiperidin-4-yl)amino]pyrimidin-4-yl]-1-methylpiperazin-2-one.
| Compound Name | 4-[6-[(1-cyclohexylpiperidin-4-yl)amino]pyrimidin-4-yl]-1-methylpiperazin-2-one |
|---|---|
| PubChem CID | 133492339 |
| Molecular Formula | C20H32N6O |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | 4-[6-[(1-cyclohexylpiperidin-4-yl)amino]pyrimidin-4-yl]-1-methylpiperazin-2-one |
| SMILES | CN1CCN(c2cc(NC3CCN(C4CCCCC4)CC3)ncn2)CC1=O |
| InChI | InChI=1S/C20H32N6O/c1-24-11-12-26(14-20(24)27)19-13-18(21-15-22-19)23-16-7-9-25(10-8-16)17-5-3-2-4-6-17/h13,15-17H,2-12,14H2,1H3,(H,21,22,23) |
| InChIKey | MIYCPULYBWHOMT-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |