C21H28N6O2 — CID 133464354
4-[6-[[1-(4-methoxyphenyl)piperidin-4-yl]amino]pyrimidin-4-yl]-1-methylpiperazin-2-one (PubChem CID 133464354) has the molecular formula C21H28N6O2 and a molecular weight of 396.50 g/mol. Its IUPAC name is 4-[6-[[1-(4-methoxyphenyl)piperidin-4-yl]amino]pyrimidin-4-yl]-1-methylpiperazin-2-one.
| Compound Name | 4-[6-[[1-(4-methoxyphenyl)piperidin-4-yl]amino]pyrimidin-4-yl]-1-methylpiperazin-2-one |
|---|---|
| PubChem CID | 133464354 |
| Molecular Formula | C21H28N6O2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 4-[6-[[1-(4-methoxyphenyl)piperidin-4-yl]amino]pyrimidin-4-yl]-1-methylpiperazin-2-one |
| SMILES | COc1ccc(N2CCC(Nc3cc(N4CCN(C)C(=O)C4)ncn3)CC2)cc1 |
| InChI | InChI=1S/C21H28N6O2/c1-25-11-12-27(14-21(25)28)20-13-19(22-15-23-20)24-16-7-9-26(10-8-16)17-3-5-18(29-2)6-4-17/h3-6,13,15-16H,7-12,14H2,1-2H3,(H,22,23,24) |
| InChIKey | VLPHNZSKNFHQKD-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|