C14H21N5O2 — CID 129398746
1-methyl-4-[6-[[(3R)-oxan-3-yl]amino]pyrimidin-4-yl]piperazin-2-one (PubChem CID 129398746) has the molecular formula C14H21N5O2 and a molecular weight of 291.35 g/mol. Its IUPAC name is 1-methyl-4-[6-[[(3R)-oxan-3-yl]amino]pyrimidin-4-yl]piperazin-2-one.
| Compound Name | 1-methyl-4-[6-[[(3R)-oxan-3-yl]amino]pyrimidin-4-yl]piperazin-2-one |
|---|---|
| PubChem CID | 129398746 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 1-methyl-4-[6-[[(3R)-oxan-3-yl]amino]pyrimidin-4-yl]piperazin-2-one |
| SMILES | CN1CCN(c2cc(N[C@@H]3CCCOC3)ncn2)CC1=O |
| InChI | InChI=1S/C14H21N5O2/c1-18-4-5-19(8-14(18)20)13-7-12(15-10-16-13)17-11-3-2-6-21-9-11/h7,10-11H,2-6,8-9H2,1H3,(H,15,16,17)/t11-/m1/s1 |
| InChIKey | TWFOFGBGXLBWFV-LLVKDONJSA-N |
| XLogP | 0.35 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |