C16H18F2N6O — CID 90544036
1-(3,4-difluorophenyl)-3-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]urea (PubChem CID 90544036) has the molecular formula C16H18F2N6O and a molecular weight of 348.36 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]urea.
| Compound Name | 1-(3,4-difluorophenyl)-3-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]urea |
|---|---|
| PubChem CID | 90544036 |
| Molecular Formula | C16H18F2N6O |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]urea |
| SMILES | CN1CCN(c2cc(NC(=O)Nc3ccc(F)c(F)c3)ncn2)CC1 |
| InChI | InChI=1S/C16H18F2N6O/c1-23-4-6-24(7-5-23)15-9-14(19-10-20-15)22-16(25)21-11-2-3-12(17)13(18)8-11/h2-3,8-10H,4-7H2,1H3,(H2,19,20,21,22,25) |
| InChIKey | PKKFJIAASPWTLS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |