C16H19ClN6O — CID 90544025
1-(3-chlorophenyl)-3-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]urea (PubChem CID 90544025) has the molecular formula C16H19ClN6O and a molecular weight of 346.82 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]urea |
|---|---|
| PubChem CID | 90544025 |
| Molecular Formula | C16H19ClN6O |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]urea |
| SMILES | CN1CCN(c2cc(NC(=O)Nc3cccc(Cl)c3)ncn2)CC1 |
| InChI | InChI=1S/C16H19ClN6O/c1-22-5-7-23(8-6-22)15-10-14(18-11-19-15)21-16(24)20-13-4-2-3-12(17)9-13/h2-4,9-11H,5-8H2,1H3,(H2,18,19,20,21,24) |
| InChIKey | PZPWYWRFJUHLMG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |