C16H20N6O — CID 90544020
1-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]-3-phenylurea (PubChem CID 90544020) has the molecular formula C16H20N6O and a molecular weight of 312.38 g/mol. Its IUPAC name is 1-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]-3-phenylurea.
| Compound Name | 1-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]-3-phenylurea |
|---|---|
| PubChem CID | 90544020 |
| Molecular Formula | C16H20N6O |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 1-[6-(4-methylpiperazin-1-yl)pyrimidin-4-yl]-3-phenylurea |
| SMILES | CN1CCN(c2cc(NC(=O)Nc3ccccc3)ncn2)CC1 |
| InChI | InChI=1S/C16H20N6O/c1-21-7-9-22(10-8-21)15-11-14(17-12-18-15)20-16(23)19-13-5-3-2-4-6-13/h2-6,11-12H,7-10H2,1H3,(H2,17,18,19,20,23) |
| InChIKey | ZQOCSTROUYELSC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |