C18H23FN6O — CID 57465551
1-(4-fluorophenyl)-3-[6-(4-propan-2-ylpiperazin-1-yl)pyrimidin-4-yl]urea (PubChem CID 57465551) has the molecular formula C18H23FN6O and a molecular weight of 358.42 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[6-(4-propan-2-ylpiperazin-1-yl)pyrimidin-4-yl]urea.
| Compound Name | 1-(4-fluorophenyl)-3-[6-(4-propan-2-ylpiperazin-1-yl)pyrimidin-4-yl]urea |
|---|---|
| PubChem CID | 57465551 |
| Molecular Formula | C18H23FN6O |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[6-(4-propan-2-ylpiperazin-1-yl)pyrimidin-4-yl]urea |
| SMILES | CC(C)N1CCN(c2cc(NC(=O)Nc3ccc(F)cc3)ncn2)CC1 |
| InChI | InChI=1S/C18H23FN6O/c1-13(2)24-7-9-25(10-8-24)17-11-16(20-12-21-17)23-18(26)22-15-5-3-14(19)4-6-15/h3-6,11-13H,7-10H2,1-2H3,(H2,20,21,22,23,26) |
| InChIKey | MDVKTXHQMTZEQD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |