C20H19F2N5 — CID 112862304
N-(3,4-difluorophenyl)-6-(4-phenylpiperazin-1-yl)pyrimidin-4-amine (PubChem CID 112862304) has the molecular formula C20H19F2N5 and a molecular weight of 367.40 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-6-(4-phenylpiperazin-1-yl)pyrimidin-4-amine.
| Compound Name | N-(3,4-difluorophenyl)-6-(4-phenylpiperazin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112862304 |
| Molecular Formula | C20H19F2N5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | N-(3,4-difluorophenyl)-6-(4-phenylpiperazin-1-yl)pyrimidin-4-amine |
| SMILES | Fc1ccc(Nc2cc(N3CCN(c4ccccc4)CC3)ncn2)cc1F |
| InChI | InChI=1S/C20H19F2N5/c21-17-7-6-15(12-18(17)22)25-19-13-20(24-14-23-19)27-10-8-26(9-11-27)16-4-2-1-3-5-16/h1-7,12-14H,8-11H2,(H,23,24,25) |
| InChIKey | OECJNIIPRSLFQC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |