C21H22FN5 — CID 112859720
N-[(4-fluorophenyl)methyl]-6-(4-phenylpiperazin-1-yl)pyrimidin-4-amine (PubChem CID 112859720) has the molecular formula C21H22FN5 and a molecular weight of 363.44 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-6-(4-phenylpiperazin-1-yl)pyrimidin-4-amine.
| Compound Name | N-[(4-fluorophenyl)methyl]-6-(4-phenylpiperazin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112859720 |
| Molecular Formula | C21H22FN5 |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-6-(4-phenylpiperazin-1-yl)pyrimidin-4-amine |
| SMILES | Fc1ccc(CNc2cc(N3CCN(c4ccccc4)CC3)ncn2)cc1 |
| InChI | InChI=1S/C21H22FN5/c22-18-8-6-17(7-9-18)15-23-20-14-21(25-16-24-20)27-12-10-26(11-13-27)19-4-2-1-3-5-19/h1-9,14,16H,10-13,15H2,(H,23,24,25) |
| InChIKey | OFALURPIXAATBT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |