C14H17FN6 — CID 80909931
[6-[4-(4-fluorophenyl)piperazin-1-yl]pyrimidin-4-yl]hydrazine (PubChem CID 80909931) has the molecular formula C14H17FN6 and a molecular weight of 288.33 g/mol. Its IUPAC name is [6-[4-(4-fluorophenyl)piperazin-1-yl]pyrimidin-4-yl]hydrazine.
| Compound Name | [6-[4-(4-fluorophenyl)piperazin-1-yl]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80909931 |
| Molecular Formula | C14H17FN6 |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | [6-[4-(4-fluorophenyl)piperazin-1-yl]pyrimidin-4-yl]hydrazine |
| SMILES | NNc1cc(N2CCN(c3ccc(F)cc3)CC2)ncn1 |
| InChI | InChI=1S/C14H17FN6/c15-11-1-3-12(4-2-11)20-5-7-21(8-6-20)14-9-13(19-16)17-10-18-14/h1-4,9-10H,5-8,16H2,(H,17,18,19) |
| InChIKey | SUZYNQAFJRQJHV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|