C14H17ClN6 — CID 80909400
[6-[4-(3-chlorophenyl)piperazin-1-yl]pyrimidin-4-yl]hydrazine (PubChem CID 80909400) has the molecular formula C14H17ClN6 and a molecular weight of 304.79 g/mol. Its IUPAC name is [6-[4-(3-chlorophenyl)piperazin-1-yl]pyrimidin-4-yl]hydrazine.
| Compound Name | [6-[4-(3-chlorophenyl)piperazin-1-yl]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80909400 |
| Molecular Formula | C14H17ClN6 |
| Molecular Weight | 304.79 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | [6-[4-(3-chlorophenyl)piperazin-1-yl]pyrimidin-4-yl]hydrazine |
| SMILES | NNc1cc(N2CCN(c3cccc(Cl)c3)CC2)ncn1 |
| InChI | InChI=1S/C14H17ClN6/c15-11-2-1-3-12(8-11)20-4-6-21(7-5-20)14-9-13(19-16)17-10-18-14/h1-3,8-10H,4-7,16H2,(H,17,18,19) |
| InChIKey | LQPSOSMKGIOPFP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.79 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|