C17H22ClN5O — CID 112856701
6-[4-(3-chlorophenyl)piperazin-1-yl]-N-(2-methoxyethyl)pyrimidin-4-amine (PubChem CID 112856701) has the molecular formula C17H22ClN5O and a molecular weight of 347.85 g/mol. Its IUPAC name is 6-[4-(3-chlorophenyl)piperazin-1-yl]-N-(2-methoxyethyl)pyrimidin-4-amine.
| Compound Name | 6-[4-(3-chlorophenyl)piperazin-1-yl]-N-(2-methoxyethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112856701 |
| Molecular Formula | C17H22ClN5O |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 6-[4-(3-chlorophenyl)piperazin-1-yl]-N-(2-methoxyethyl)pyrimidin-4-amine |
| SMILES | COCCNc1cc(N2CCN(c3cccc(Cl)c3)CC2)ncn1 |
| InChI | InChI=1S/C17H22ClN5O/c1-24-10-5-19-16-12-17(21-13-20-16)23-8-6-22(7-9-23)15-4-2-3-14(18)11-15/h2-4,11-13H,5-10H2,1H3,(H,19,20,21) |
| InChIKey | UBZDGBALDRDYDG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|