C22H24FN5 — CID 112858906
6-[4-(4-fluorophenyl)piperazin-1-yl]-N-[(2-methylphenyl)methyl]pyrimidin-4-amine (PubChem CID 112858906) has the molecular formula C22H24FN5 and a molecular weight of 377.47 g/mol. Its IUPAC name is 6-[4-(4-fluorophenyl)piperazin-1-yl]-N-[(2-methylphenyl)methyl]pyrimidin-4-amine.
| Compound Name | 6-[4-(4-fluorophenyl)piperazin-1-yl]-N-[(2-methylphenyl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 112858906 |
| Molecular Formula | C22H24FN5 |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 6-[4-(4-fluorophenyl)piperazin-1-yl]-N-[(2-methylphenyl)methyl]pyrimidin-4-amine |
| SMILES | Cc1ccccc1CNc1cc(N2CCN(c3ccc(F)cc3)CC2)ncn1 |
| InChI | InChI=1S/C22H24FN5/c1-17-4-2-3-5-18(17)15-24-21-14-22(26-16-25-21)28-12-10-27(11-13-28)20-8-6-19(23)7-9-20/h2-9,14,16H,10-13,15H2,1H3,(H,24,25,26) |
| InChIKey | NXBBUIGGQBMNQC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |