C18H23N5O3 — CID 90544779
1-(2,3-dimethoxyphenyl)-3-(6-piperidin-1-ylpyrimidin-4-yl)urea (PubChem CID 90544779) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is 1-(2,3-dimethoxyphenyl)-3-(6-piperidin-1-ylpyrimidin-4-yl)urea.
| Compound Name | 1-(2,3-dimethoxyphenyl)-3-(6-piperidin-1-ylpyrimidin-4-yl)urea |
|---|---|
| PubChem CID | 90544779 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 1-(2,3-dimethoxyphenyl)-3-(6-piperidin-1-ylpyrimidin-4-yl)urea |
| SMILES | COc1cccc(NC(=O)Nc2cc(N3CCCCC3)ncn2)c1OC |
| InChI | InChI=1S/C18H23N5O3/c1-25-14-8-6-7-13(17(14)26-2)21-18(24)22-15-11-16(20-12-19-15)23-9-4-3-5-10-23/h6-8,11-12H,3-5,9-10H2,1-2H3,(H2,19,20,21,22,24) |
| InChIKey | WMHJKJRIUHOBEW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |