C17H19N5O6 — CID 90544101
4,5-dimethoxy-N-(6-morpholin-4-ylpyrimidin-4-yl)-2-nitrobenzamide (PubChem CID 90544101) has the molecular formula C17H19N5O6 and a molecular weight of 389.37 g/mol. Its IUPAC name is 4,5-dimethoxy-N-(6-morpholin-4-ylpyrimidin-4-yl)-2-nitrobenzamide.
| Compound Name | 4,5-dimethoxy-N-(6-morpholin-4-ylpyrimidin-4-yl)-2-nitrobenzamide |
|---|---|
| PubChem CID | 90544101 |
| Molecular Formula | C17H19N5O6 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 4,5-dimethoxy-N-(6-morpholin-4-ylpyrimidin-4-yl)-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)Nc2cc(N3CCOCC3)ncn2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C17H19N5O6/c1-26-13-7-11(12(22(24)25)8-14(13)27-2)17(23)20-15-9-16(19-10-18-15)21-3-5-28-6-4-21/h7-10H,3-6H2,1-2H3,(H,18,19,20,23) |
| InChIKey | ZSLOHLRLAWLUEL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 128.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|