C21H25N3O6 — CID 16889592
4,5-dimethoxy-N-[2-(4-morpholin-4-ylphenyl)ethyl]-2-nitrobenzamide (PubChem CID 16889592) has the molecular formula C21H25N3O6 and a molecular weight of 415.45 g/mol. Its IUPAC name is 4,5-dimethoxy-N-[2-(4-morpholin-4-ylphenyl)ethyl]-2-nitrobenzamide.
| Compound Name | 4,5-dimethoxy-N-[2-(4-morpholin-4-ylphenyl)ethyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 16889592 |
| Molecular Formula | C21H25N3O6 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 4,5-dimethoxy-N-[2-(4-morpholin-4-ylphenyl)ethyl]-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)NCCc2ccc(N3CCOCC3)cc2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C21H25N3O6/c1-28-19-13-17(18(24(26)27)14-20(19)29-2)21(25)22-8-7-15-3-5-16(6-4-15)23-9-11-30-12-10-23/h3-6,13-14H,7-12H2,1-2H3,(H,22,25) |
| InChIKey | XSJURXGHGYWPQV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|