C20H24N4O5 — CID 121108816
4,5-dimethoxy-2-nitro-N-[(1-pyridin-4-ylpiperidin-4-yl)methyl]benzamide (PubChem CID 121108816) has the molecular formula C20H24N4O5 and a molecular weight of 400.44 g/mol. Its IUPAC name is 4,5-dimethoxy-2-nitro-N-[(1-pyridin-4-ylpiperidin-4-yl)methyl]benzamide.
| Compound Name | 4,5-dimethoxy-2-nitro-N-[(1-pyridin-4-ylpiperidin-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 121108816 |
| Molecular Formula | C20H24N4O5 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 4,5-dimethoxy-2-nitro-N-[(1-pyridin-4-ylpiperidin-4-yl)methyl]benzamide |
| SMILES | COc1cc(C(=O)NCC2CCN(c3ccncc3)CC2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C20H24N4O5/c1-28-18-11-16(17(24(26)27)12-19(18)29-2)20(25)22-13-14-5-9-23(10-6-14)15-3-7-21-8-4-15/h3-4,7-8,11-12,14H,5-6,9-10,13H2,1-2H3,(H,22,25) |
| InChIKey | DFTBSZHAIGFJSJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 106.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|