C19H23N3O6S — CID 16931698
4,5-dimethoxy-N-(2-morpholin-4-yl-2-thiophen-3-ylethyl)-2-nitrobenzamide (PubChem CID 16931698) has the molecular formula C19H23N3O6S and a molecular weight of 421.48 g/mol. Its IUPAC name is 4,5-dimethoxy-N-(2-morpholin-4-yl-2-thiophen-3-ylethyl)-2-nitrobenzamide.
| Compound Name | 4,5-dimethoxy-N-(2-morpholin-4-yl-2-thiophen-3-ylethyl)-2-nitrobenzamide |
|---|---|
| PubChem CID | 16931698 |
| Molecular Formula | C19H23N3O6S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | 4,5-dimethoxy-N-(2-morpholin-4-yl-2-thiophen-3-ylethyl)-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)NCC(c2ccsc2)N2CCOCC2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C19H23N3O6S/c1-26-17-9-14(15(22(24)25)10-18(17)27-2)19(23)20-11-16(13-3-8-29-12-13)21-4-6-28-7-5-21/h3,8-10,12,16H,4-7,11H2,1-2H3,(H,20,23) |
| InChIKey | HKAHTKKSMZSTCP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|