C17H18F2N2O2S — CID 16931663
2,6-difluoro-N-(2-morpholin-4-yl-2-thiophen-3-ylethyl)benzamide (PubChem CID 16931663) has the molecular formula C17H18F2N2O2S and a molecular weight of 352.41 g/mol. Its IUPAC name is 2,6-difluoro-N-(2-morpholin-4-yl-2-thiophen-3-ylethyl)benzamide.
| Compound Name | 2,6-difluoro-N-(2-morpholin-4-yl-2-thiophen-3-ylethyl)benzamide |
|---|---|
| PubChem CID | 16931663 |
| Molecular Formula | C17H18F2N2O2S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 2,6-difluoro-N-(2-morpholin-4-yl-2-thiophen-3-ylethyl)benzamide |
| SMILES | O=C(NCC(c1ccsc1)N1CCOCC1)c1c(F)cccc1F |
| InChI | InChI=1S/C17H18F2N2O2S/c18-13-2-1-3-14(19)16(13)17(22)20-10-15(12-4-9-24-11-12)21-5-7-23-8-6-21/h1-4,9,11,15H,5-8,10H2,(H,20,22) |
| InChIKey | USXSQRDCMGNNTL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |