C20H20F2N2O4 — CID 7285631
N-[(2S)-2-(1,3-benzodioxol-5-yl)-2-morpholin-4-ylethyl]-2,6-difluorobenzamide (PubChem CID 7285631) has the molecular formula C20H20F2N2O4 and a molecular weight of 390.39 g/mol. Its IUPAC name is N-[(2S)-2-(1,3-benzodioxol-5-yl)-2-morpholin-4-ylethyl]-2,6-difluorobenzamide.
| Compound Name | N-[(2S)-2-(1,3-benzodioxol-5-yl)-2-morpholin-4-ylethyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 7285631 |
| Molecular Formula | C20H20F2N2O4 |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | N-[(2S)-2-(1,3-benzodioxol-5-yl)-2-morpholin-4-ylethyl]-2,6-difluorobenzamide |
| SMILES | O=C(NC[C@H](c1ccc2c(c1)OCO2)N1CCOCC1)c1c(F)cccc1F |
| InChI | InChI=1S/C20H20F2N2O4/c21-14-2-1-3-15(22)19(14)20(25)23-11-16(24-6-8-26-9-7-24)13-4-5-17-18(10-13)28-12-27-17/h1-5,10,16H,6-9,11-12H2,(H,23,25)/t16-/m1/s1 |
| InChIKey | IEJDBDVCGAHFDQ-MRXNPFEDSA-N |
| XLogP | 2.50 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |