C18H21N5O7S — CID 46656918
N'-(5-ethoxy-4-methoxy-2-nitrobenzoyl)-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide (PubChem CID 46656918) has the molecular formula C18H21N5O7S and a molecular weight of 451.46 g/mol. Its IUPAC name is N'-(5-ethoxy-4-methoxy-2-nitrobenzoyl)-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide.
| Compound Name | N'-(5-ethoxy-4-methoxy-2-nitrobenzoyl)-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 46656918 |
| Molecular Formula | C18H21N5O7S |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | N'-(5-ethoxy-4-methoxy-2-nitrobenzoyl)-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide |
| SMILES | CCOc1cc(C(=O)NNC(=O)c2csc(N3CCOCC3)n2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C18H21N5O7S/c1-3-30-15-8-11(13(23(26)27)9-14(15)28-2)16(24)20-21-17(25)12-10-31-18(19-12)22-4-6-29-7-5-22/h8-10H,3-7H2,1-2H3,(H,20,24)(H,21,25) |
| InChIKey | NKMBCYLMXBWVGX-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 145.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|