C23H25N5O6S2 — CID 24980855
N-(4-methoxyphenyl)-4-methyl-3-[[(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)amino]carbamoyl]benzenesulfonamide (PubChem CID 24980855) has the molecular formula C23H25N5O6S2 and a molecular weight of 531.62 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-4-methyl-3-[[(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)amino]carbamoyl]benzenesulfonamide.
| Compound Name | N-(4-methoxyphenyl)-4-methyl-3-[[(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)amino]carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24980855 |
| Molecular Formula | C23H25N5O6S2 |
| Molecular Weight | 531.62 g/mol |
| Exact Mass | 531.12 |
| IUPAC Name | N-(4-methoxyphenyl)-4-methyl-3-[[(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)amino]carbamoyl]benzenesulfonamide |
| SMILES | COc1ccc(NS(=O)(=O)c2ccc(C)c(C(=O)NNC(=O)c3csc(N4CCOCC4)n3)c2)cc1 |
| InChI | InChI=1S/C23H25N5O6S2/c1-15-3-8-18(36(31,32)27-16-4-6-17(33-2)7-5-16)13-19(15)21(29)25-26-22(30)20-14-35-23(24-20)28-9-11-34-12-10-28/h3-8,13-14,27H,9-12H2,1-2H3,(H,25,29)(H,26,30) |
| InChIKey | YZYNVXGWEBMCQR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 138.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.62 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|