C20H27N5O6S2 — CID 31717997
4-methoxy-N-[(2S)-3-methyl-1-[2-(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)hydrazinyl]-1-oxobutan-2-yl]benzenesulfonamide (PubChem CID 31717997) has the molecular formula C20H27N5O6S2 and a molecular weight of 497.60 g/mol. Its IUPAC name is 4-methoxy-N-[(2S)-3-methyl-1-[2-(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)hydrazinyl]-1-oxobutan-2-yl]benzenesulfonamide.
| Compound Name | 4-methoxy-N-[(2S)-3-methyl-1-[2-(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)hydrazinyl]-1-oxobutan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 31717997 |
| Molecular Formula | C20H27N5O6S2 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | 4-methoxy-N-[(2S)-3-methyl-1-[2-(2-morpholin-4-yl-1,3-thiazole-4-carbonyl)hydrazinyl]-1-oxobutan-2-yl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N[C@H](C(=O)NNC(=O)c2csc(N3CCOCC3)n2)C(C)C)cc1 |
| InChI | InChI=1S/C20H27N5O6S2/c1-13(2)17(24-33(28,29)15-6-4-14(30-3)5-7-15)19(27)23-22-18(26)16-12-32-20(21-16)25-8-10-31-11-9-25/h4-7,12-13,17,24H,8-11H2,1-3H3,(H,22,26)(H,23,27)/t17-/m0/s1 |
| InChIKey | GZPGRHHRDWPQQX-KRWDZBQOSA-N |
| XLogP | 0.75 |
| TPSA | 138.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|