C15H17BrN4O4S2 — CID 17498202
N'-(4-bromo-3-methylphenyl)sulfonyl-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide (PubChem CID 17498202) has the molecular formula C15H17BrN4O4S2 and a molecular weight of 461.36 g/mol. Its IUPAC name is N'-(4-bromo-3-methylphenyl)sulfonyl-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide.
| Compound Name | N'-(4-bromo-3-methylphenyl)sulfonyl-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 17498202 |
| Molecular Formula | C15H17BrN4O4S2 |
| Molecular Weight | 461.36 g/mol |
| Exact Mass | 459.99 |
| IUPAC Name | N'-(4-bromo-3-methylphenyl)sulfonyl-2-morpholin-4-yl-1,3-thiazole-4-carbohydrazide |
| SMILES | Cc1cc(S(=O)(=O)NNC(=O)c2csc(N3CCOCC3)n2)ccc1Br |
| InChI | InChI=1S/C15H17BrN4O4S2/c1-10-8-11(2-3-12(10)16)26(22,23)19-18-14(21)13-9-25-15(17-13)20-4-6-24-7-5-20/h2-3,8-9,19H,4-7H2,1H3,(H,18,21) |
| InChIKey | DHNHJJQAZJJMJN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|