C18H22N4O4S2 — CID 26950970
2-morpholin-4-yl-N'-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)-1,3-thiazole-4-carbohydrazide (PubChem CID 26950970) has the molecular formula C18H22N4O4S2 and a molecular weight of 422.53 g/mol. Its IUPAC name is 2-morpholin-4-yl-N'-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)-1,3-thiazole-4-carbohydrazide.
| Compound Name | 2-morpholin-4-yl-N'-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 26950970 |
| Molecular Formula | C18H22N4O4S2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 2-morpholin-4-yl-N'-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)-1,3-thiazole-4-carbohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1ccc2c(c1)CCCC2)c1csc(N2CCOCC2)n1 |
| InChI | InChI=1S/C18H22N4O4S2/c23-17(16-12-27-18(19-16)22-7-9-26-10-8-22)20-21-28(24,25)15-6-5-13-3-1-2-4-14(13)11-15/h5-6,11-12,21H,1-4,7-10H2,(H,20,23) |
| InChIKey | CPCFDRIJDJTIEY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|