C19H22N4O2S — CID 71903261
2-morpholin-4-yl-N-(6,7,8,9-tetrahydrobenzo[7]annulen-5-ylideneamino)-1,3-thiazole-4-carboxamide (PubChem CID 71903261) has the molecular formula C19H22N4O2S and a molecular weight of 370.48 g/mol. Its IUPAC name is 2-morpholin-4-yl-N-(6,7,8,9-tetrahydrobenzo[7]annulen-5-ylideneamino)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-morpholin-4-yl-N-(6,7,8,9-tetrahydrobenzo[7]annulen-5-ylideneamino)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 71903261 |
| Molecular Formula | C19H22N4O2S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 2-morpholin-4-yl-N-(6,7,8,9-tetrahydrobenzo[7]annulen-5-ylideneamino)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NN=C1CCCCc2ccccc21)c1csc(N2CCOCC2)n1 |
| InChI | InChI=1S/C19H22N4O2S/c24-18(17-13-26-19(20-17)23-9-11-25-12-10-23)22-21-16-8-4-2-6-14-5-1-3-7-15(14)16/h1,3,5,7,13H,2,4,6,8-12H2,(H,22,24) |
| InChIKey | FNWRYBHLUJJLGI-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|