C23H26N6O2S — CID 117085603
N-(4-morpholin-4-ylphenyl)-2-(4-pyridin-2-ylpiperazin-1-yl)-1,3-thiazole-4-carboxamide (PubChem CID 117085603) has the molecular formula C23H26N6O2S and a molecular weight of 450.57 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-2-(4-pyridin-2-ylpiperazin-1-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(4-morpholin-4-ylphenyl)-2-(4-pyridin-2-ylpiperazin-1-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 117085603 |
| Molecular Formula | C23H26N6O2S |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-2-(4-pyridin-2-ylpiperazin-1-yl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)cc1)c1csc(N2CCN(c3ccccn3)CC2)n1 |
| InChI | InChI=1S/C23H26N6O2S/c30-22(25-18-4-6-19(7-5-18)27-13-15-31-16-14-27)20-17-32-23(26-20)29-11-9-28(10-12-29)21-3-1-2-8-24-21/h1-8,17H,9-16H2,(H,25,30) |
| InChIKey | MHFPKDLHGYFPFJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|