C17H17N5O3S2 — CID 18155737
2-morpholin-4-yl-N'-(3-pyrrol-1-ylthiophene-2-carbonyl)-1,3-thiazole-4-carbohydrazide (PubChem CID 18155737) has the molecular formula C17H17N5O3S2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 2-morpholin-4-yl-N'-(3-pyrrol-1-ylthiophene-2-carbonyl)-1,3-thiazole-4-carbohydrazide.
| Compound Name | 2-morpholin-4-yl-N'-(3-pyrrol-1-ylthiophene-2-carbonyl)-1,3-thiazole-4-carbohydrazide |
|---|---|
| PubChem CID | 18155737 |
| Molecular Formula | C17H17N5O3S2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | 2-morpholin-4-yl-N'-(3-pyrrol-1-ylthiophene-2-carbonyl)-1,3-thiazole-4-carbohydrazide |
| SMILES | O=C(NNC(=O)c1sccc1-n1cccc1)c1csc(N2CCOCC2)n1 |
| InChI | InChI=1S/C17H17N5O3S2/c23-15(12-11-27-17(18-12)22-6-8-25-9-7-22)19-20-16(24)14-13(3-10-26-14)21-4-1-2-5-21/h1-5,10-11H,6-9H2,(H,19,23)(H,20,24) |
| InChIKey | ZWFGUAVDIDORDE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|