C15H14F2N4O2S — CID 55352710
N-[(E)-(3,4-difluorophenyl)methylideneamino]-2-morpholin-4-yl-1,3-thiazole-4-carboxamide (PubChem CID 55352710) has the molecular formula C15H14F2N4O2S and a molecular weight of 352.37 g/mol. Its IUPAC name is N-[(E)-(3,4-difluorophenyl)methylideneamino]-2-morpholin-4-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(E)-(3,4-difluorophenyl)methylideneamino]-2-morpholin-4-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 55352710 |
| Molecular Formula | C15H14F2N4O2S |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | N-[(E)-(3,4-difluorophenyl)methylideneamino]-2-morpholin-4-yl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(N/N=C/c1ccc(F)c(F)c1)c1csc(N2CCOCC2)n1 |
| InChI | InChI=1S/C15H14F2N4O2S/c16-11-2-1-10(7-12(11)17)8-18-20-14(22)13-9-24-15(19-13)21-3-5-23-6-4-21/h1-2,7-9H,3-6H2,(H,20,22)/b18-8+ |
| InChIKey | PODDEOBEHAOENM-QGMBQPNBSA-N |
| XLogP | 2.02 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|