C18H16Cl2FN3O2 — CID 126136661
2,4-dichloro-N-[(Z)-(3-fluoro-4-morpholin-4-ylphenyl)methylideneamino]benzamide (PubChem CID 126136661) has the molecular formula C18H16Cl2FN3O2 and a molecular weight of 396.25 g/mol. Its IUPAC name is 2,4-dichloro-N-[(Z)-(3-fluoro-4-morpholin-4-ylphenyl)methylideneamino]benzamide.
| Compound Name | 2,4-dichloro-N-[(Z)-(3-fluoro-4-morpholin-4-ylphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 126136661 |
| Molecular Formula | C18H16Cl2FN3O2 |
| Molecular Weight | 396.25 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 2,4-dichloro-N-[(Z)-(3-fluoro-4-morpholin-4-ylphenyl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1ccc(N2CCOCC2)c(F)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H16Cl2FN3O2/c19-13-2-3-14(15(20)10-13)18(25)23-22-11-12-1-4-17(16(21)9-12)24-5-7-26-8-6-24/h1-4,9-11H,5-8H2,(H,23,25)/b22-11- |
| InChIKey | HJXJGFNESUPGFY-JJFYIABZSA-N |
| XLogP | 3.73 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.25 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|