C18H16Cl2FN3O — CID 126072342
3,4-dichloro-N-[(Z)-(3-fluoro-4-pyrrolidin-1-ylphenyl)methylideneamino]benzamide (PubChem CID 126072342) has the molecular formula C18H16Cl2FN3O and a molecular weight of 380.25 g/mol. Its IUPAC name is 3,4-dichloro-N-[(Z)-(3-fluoro-4-pyrrolidin-1-ylphenyl)methylideneamino]benzamide.
| Compound Name | 3,4-dichloro-N-[(Z)-(3-fluoro-4-pyrrolidin-1-ylphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 126072342 |
| Molecular Formula | C18H16Cl2FN3O |
| Molecular Weight | 380.25 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 3,4-dichloro-N-[(Z)-(3-fluoro-4-pyrrolidin-1-ylphenyl)methylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1ccc(N2CCCC2)c(F)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H16Cl2FN3O/c19-14-5-4-13(10-15(14)20)18(25)23-22-11-12-3-6-17(16(21)9-12)24-7-1-2-8-24/h3-6,9-11H,1-2,7-8H2,(H,23,25)/b22-11- |
| InChIKey | JMAJIPNPHYIRQL-JJFYIABZSA-N |
| XLogP | 4.50 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.25 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|