C16H12Cl2N2O4 — CID 94849130
5-[(Z)-[(3,4-dichlorobenzoyl)hydrazinylidene]methyl]-2-methoxybenzoic acid (PubChem CID 94849130) has the molecular formula C16H12Cl2N2O4 and a molecular weight of 367.19 g/mol. Its IUPAC name is 5-[(Z)-[(3,4-dichlorobenzoyl)hydrazinylidene]methyl]-2-methoxybenzoic acid.
| Compound Name | 5-[(Z)-[(3,4-dichlorobenzoyl)hydrazinylidene]methyl]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 94849130 |
| Molecular Formula | C16H12Cl2N2O4 |
| Molecular Weight | 367.19 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | 5-[(Z)-[(3,4-dichlorobenzoyl)hydrazinylidene]methyl]-2-methoxybenzoic acid |
| SMILES | COc1ccc(/C=N\NC(=O)c2ccc(Cl)c(Cl)c2)cc1C(=O)O |
| InChI | InChI=1S/C16H12Cl2N2O4/c1-24-14-5-2-9(6-11(14)16(22)23)8-19-20-15(21)10-3-4-12(17)13(18)7-10/h2-8H,1H3,(H,20,21)(H,22,23)/b19-8- |
| InChIKey | NBHDCKKRAKNXCK-UWVJOHFNSA-N |
| XLogP | 3.46 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.19 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|