C20H21FN2O2 — CID 126107267
methyl 4-[(3-fluoro-4-pyrrolidin-1-ylphenyl)methylideneamino]-3-methylbenzoate (PubChem CID 126107267) has the molecular formula C20H21FN2O2 and a molecular weight of 340.40 g/mol. Its IUPAC name is methyl 4-[(3-fluoro-4-pyrrolidin-1-ylphenyl)methylideneamino]-3-methylbenzoate.
| Compound Name | methyl 4-[(3-fluoro-4-pyrrolidin-1-ylphenyl)methylideneamino]-3-methylbenzoate |
|---|---|
| PubChem CID | 126107267 |
| Molecular Formula | C20H21FN2O2 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | methyl 4-[(3-fluoro-4-pyrrolidin-1-ylphenyl)methylideneamino]-3-methylbenzoate |
| SMILES | COC(=O)c1ccc(/N=C/c2ccc(N3CCCC3)c(F)c2)c(C)c1 |
| InChI | InChI=1S/C20H21FN2O2/c1-14-11-16(20(24)25-2)6-7-18(14)22-13-15-5-8-19(17(21)12-15)23-9-3-4-10-23/h5-8,11-13H,3-4,9-10H2,1-2H3/b22-13+ |
| InChIKey | XGYNZDXRSAFRME-LPYMAVHISA-N |
| XLogP | 4.27 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|