C18H18F2N2 — CID 126072704
N-(4-fluoro-3-methylphenyl)-1-(3-fluoro-4-pyrrolidin-1-ylphenyl)methanimine (PubChem CID 126072704) has the molecular formula C18H18F2N2 and a molecular weight of 300.35 g/mol. Its IUPAC name is N-(4-fluoro-3-methylphenyl)-1-(3-fluoro-4-pyrrolidin-1-ylphenyl)methanimine.
| Compound Name | N-(4-fluoro-3-methylphenyl)-1-(3-fluoro-4-pyrrolidin-1-ylphenyl)methanimine |
|---|---|
| PubChem CID | 126072704 |
| Molecular Formula | C18H18F2N2 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | N-(4-fluoro-3-methylphenyl)-1-(3-fluoro-4-pyrrolidin-1-ylphenyl)methanimine |
| SMILES | Cc1cc(/N=C/c2ccc(N3CCCC3)c(F)c2)ccc1F |
| InChI | InChI=1S/C18H18F2N2/c1-13-10-15(5-6-16(13)19)21-12-14-4-7-18(17(20)11-14)22-8-2-3-9-22/h4-7,10-12H,2-3,8-9H2,1H3/b21-12+ |
| InChIKey | BSUXKFORGSNZHE-CIAFOILYSA-N |
| XLogP | 4.62 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|