C19H21FN2 — CID 126075339
N-(2,4-dimethylphenyl)-1-(3-fluoro-4-pyrrolidin-1-ylphenyl)methanimine (PubChem CID 126075339) has the molecular formula C19H21FN2 and a molecular weight of 296.39 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-1-(3-fluoro-4-pyrrolidin-1-ylphenyl)methanimine.
| Compound Name | N-(2,4-dimethylphenyl)-1-(3-fluoro-4-pyrrolidin-1-ylphenyl)methanimine |
|---|---|
| PubChem CID | 126075339 |
| Molecular Formula | C19H21FN2 |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | N-(2,4-dimethylphenyl)-1-(3-fluoro-4-pyrrolidin-1-ylphenyl)methanimine |
| SMILES | Cc1ccc(/N=C/c2ccc(N3CCCC3)c(F)c2)c(C)c1 |
| InChI | InChI=1S/C19H21FN2/c1-14-5-7-18(15(2)11-14)21-13-16-6-8-19(17(20)12-16)22-9-3-4-10-22/h5-8,11-13H,3-4,9-10H2,1-2H3/b21-13+ |
| InChIKey | UYZFFLCZHZKDKN-FYJGNVAPSA-N |
| XLogP | 4.79 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|