C22H28N2 — CID 50858531
N-(2,4-dimethylphenyl)-1-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methanimine (PubChem CID 50858531) has the molecular formula C22H28N2 and a molecular weight of 320.48 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-1-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methanimine.
| Compound Name | N-(2,4-dimethylphenyl)-1-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methanimine |
|---|---|
| PubChem CID | 50858531 |
| Molecular Formula | C22H28N2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | N-(2,4-dimethylphenyl)-1-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methanimine |
| SMILES | Cc1ccc(/N=C/c2ccc3c(c2)C(C)CC(C)(C)N3C)c(C)c1 |
| InChI | InChI=1S/C22H28N2/c1-15-7-9-20(16(2)11-15)23-14-18-8-10-21-19(12-18)17(3)13-22(4,5)24(21)6/h7-12,14,17H,13H2,1-6H3/b23-14+ |
| InChIKey | DQBBQJUKUSOBGP-OEAKJJBVSA-N |
| XLogP | 5.78 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|