C24H32N2 — CID 50858629
N-(4-tert-butylphenyl)-1-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methanimine (PubChem CID 50858629) has the molecular formula C24H32N2 and a molecular weight of 348.53 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-1-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methanimine.
| Compound Name | N-(4-tert-butylphenyl)-1-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methanimine |
|---|---|
| PubChem CID | 50858629 |
| Molecular Formula | C24H32N2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.26 |
| IUPAC Name | N-(4-tert-butylphenyl)-1-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methanimine |
| SMILES | CC1CC(C)(C)N(C)c2ccc(/C=N/c3ccc(C(C)(C)C)cc3)cc21 |
| InChI | InChI=1S/C24H32N2/c1-17-15-24(5,6)26(7)22-13-8-18(14-21(17)22)16-25-20-11-9-19(10-12-20)23(2,3)4/h8-14,16-17H,15H2,1-7H3/b25-16+ |
| InChIKey | PEYNBVGJBFGCKB-PCLIKHOPSA-N |
| XLogP | 6.46 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|