C20H25N3 — CID 75560608
N-[(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]aniline (PubChem CID 75560608) has the molecular formula C20H25N3 and a molecular weight of 307.44 g/mol. Its IUPAC name is N-[(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]aniline.
| Compound Name | N-[(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]aniline |
|---|---|
| PubChem CID | 75560608 |
| Molecular Formula | C20H25N3 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | N-[(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]aniline |
| SMILES | CC1CC(C)(C)N(C)c2ccc(C=NNc3ccccc3)cc21 |
| InChI | InChI=1S/C20H25N3/c1-15-13-20(2,3)23(4)19-11-10-16(12-18(15)19)14-21-22-17-8-6-5-7-9-17/h5-12,14-15,22H,13H2,1-4H3 |
| InChIKey | VNCZCGHWLWWFFS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|