C20H24N4O — CID 99885543
N-[(Z)-[(4R)-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylideneamino]pyridine-2-carboxamide (PubChem CID 99885543) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is N-[(Z)-[(4R)-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylideneamino]pyridine-2-carboxamide.
| Compound Name | N-[(Z)-[(4R)-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylideneamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 99885543 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | N-[(Z)-[(4R)-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylideneamino]pyridine-2-carboxamide |
| SMILES | C[C@@H]1CC(C)(C)N(C)c2ccc(/C=N\NC(=O)c3ccccn3)cc21 |
| InChI | InChI=1S/C20H24N4O/c1-14-12-20(2,3)24(4)18-9-8-15(11-16(14)18)13-22-23-19(25)17-7-5-6-10-21-17/h5-11,13-14H,12H2,1-4H3,(H,23,25)/b22-13-/t14-/m1/s1 |
| InChIKey | OTTSOVLYUQZXRN-BXSODOALSA-N |
| XLogP | 3.57 |
| TPSA | 57.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|