C21H24ClN3O — CID 133170286
4-chloro-N-[(E)-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide (PubChem CID 133170286) has the molecular formula C21H24ClN3O and a molecular weight of 369.90 g/mol. Its IUPAC name is 4-chloro-N-[(E)-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide.
| Compound Name | 4-chloro-N-[(E)-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 133170286 |
| Molecular Formula | C21H24ClN3O |
| Molecular Weight | 369.90 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 4-chloro-N-[(E)-(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylideneamino]benzamide |
| SMILES | CC1CC(C)(C)N(C)c2ccc(/C=N/NC(=O)c3ccc(Cl)cc3)cc21 |
| InChI | InChI=1S/C21H24ClN3O/c1-14-12-21(2,3)25(4)19-10-5-15(11-18(14)19)13-23-24-20(26)16-6-8-17(22)9-7-16/h5-11,13-14H,12H2,1-4H3,(H,24,26)/b23-13+ |
| InChIKey | WCPVPUGIUAQXPI-YDZHTSKRSA-N |
| XLogP | 4.83 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.90 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|