C16H23N3O — CID 99885591
N-[(Z)-[(4R)-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylideneamino]acetamide (PubChem CID 99885591) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is N-[(Z)-[(4R)-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylideneamino]acetamide.
| Compound Name | N-[(Z)-[(4R)-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 99885591 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | N-[(Z)-[(4R)-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylideneamino]acetamide |
| SMILES | CC(=O)N/N=C\c1ccc2c(c1)[C@H](C)CC(C)(C)N2C |
| InChI | InChI=1S/C16H23N3O/c1-11-9-16(3,4)19(5)15-7-6-13(8-14(11)15)10-17-18-12(2)20/h6-8,10-11H,9H2,1-5H3,(H,18,20)/b17-10-/t11-/m1/s1 |
| InChIKey | MODKMDWLRJNGLJ-VBYYMIJXSA-N |
| XLogP | 2.88 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|